|
CAS#: 24478-10-2 Product: 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine; 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)-S-Triazine; 1,3,5-Triazine, 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H3Cl8N3S |
| Molecular Weight | 492.85 |
| CAS Registry Number | 24478-10-2 |
| SMILES | C1=C(C=CC(=C1Cl)Cl)SC2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C11H3Cl8N3S/c12-5-2-1-4(3-6(5)13)23-9-21-7(10(14,15)16)20-8(22-9)11(17,18)19/h1-3H |
| InChIKey | SGYKVZVJJMGSEH-UHFFFAOYSA-N |
| Density | 1.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.751°C at 760 mmHg (Cal.) |
| Flash point | 269.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(3,4-Dichlorophenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |