|
CAS#: 24558-01-8 Product: Levophacetoperane No suppilers available for the product. |
| Name | Levophacetoperane |
|---|---|
| Synonyms | [(S)-Phenyl-[(2S)-2-Piperidyl]Methyl] Acetate; Acetic Acid [(S)-Phenyl-[(2S)-2-Piperidinyl]Methyl] Ester; Acetic Acid [(S)-Phenyl-[(2S)-2-Piperidyl]Methyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 |
| CAS Registry Number | 24558-01-8 |
| SMILES | [C@H]1(CCCCN1)[C@@H](OC(=O)C)C2=CC=CC=C2 |
| InChI | 1S/C14H19NO2/c1-11(16)17-14(12-7-3-2-4-8-12)13-9-5-6-10-15-13/h2-4,7-8,13-15H,5-6,9-10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | BKPLVPRTTWIDNL-KBPBESRZSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.1±17.0°C at 760 mmHg (Cal.) |
| Flash point | 150.4±20.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Levophacetoperane |