|
CAS#: 24648-52-0 Product: N-Carboxymethylisatoic Anhydride No suppilers available for the product. |
| Name | N-Carboxymethylisatoic Anhydride |
|---|---|
| Synonyms | 2-(2,4-Diketo-3,1-Benzoxazin-1-Yl)Acetic Acid; 2-(2,4-Dioxo-3,1-Benzoxazin-1-Yl)Ethanoic Acid; 2H-3,1-Benzoxazine-1(4H)-Acetic Acid, 2,4-Dioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 |
| CAS Registry Number | 24648-52-0 |
| SMILES | C1=CC=CC2=C1N(C(OC2=O)=O)CC(O)=O |
| InChI | 1S/C10H7NO5/c12-8(13)5-11-7-4-2-1-3-6(7)9(14)16-10(11)15/h1-4H,5H2,(H,12,13) |
| InChIKey | CXRYHXNGBDHERE-UHFFFAOYSA-N |
| Density | 1.541g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.789°C at 760 mmHg (Cal.) |
| Flash point | 222.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Carboxymethylisatoic Anhydride |