|
CAS#: 24731-94-0 Product: Ethyl N-[4-[4-(Ethoxycarbonylamino)Phenyl]Sulfonylphenyl]Carbamate No suppilers available for the product. |
| Name | Ethyl N-[4-[4-(Ethoxycarbonylamino)Phenyl]Sulfonylphenyl]Carbamate |
|---|---|
| Synonyms | N-[4-[4-(Ethoxycarbonylamino)Phenyl]Sulfonylphenyl]Carbamic Acid Ethyl Ester; N-[4-[4-(Carbethoxyamino)Phenyl]Sulfonylphenyl]Carbamic Acid Ethyl Ester; Nsc28760 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 |
| CAS Registry Number | 24731-94-0 |
| SMILES | C1=CC(=CC=C1[S](=O)(C2=CC=C(NC(OCC)=O)C=C2)=O)NC(=O)OCC |
| InChI | 1S/C18H20N2O6S/c1-3-25-17(21)19-13-5-9-15(10-6-13)27(23,24)16-11-7-14(8-12-16)20-18(22)26-4-2/h5-12H,3-4H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | XPGVDCZHMCFPOK-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.996°C at 760 mmHg (Cal.) |
| Flash point | 253.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-[4-[4-(Ethoxycarbonylamino)Phenyl]Sulfonylphenyl]Carbamate |