|
CAS#: 24740-92-9 Product: 3-(4-Pentoxybenzoyl)-3-bromoacrylic acid No suppilers available for the product. |
| Name | 3-(4-Pentoxybenzoyl)-3-bromoacrylic acid |
|---|---|
| Synonyms | (Z)-3-Bromo-4-Oxo-4-(4-Pentoxyphenyl)But-2-Enoic Acid; 4-(4-Amoxyphenyl)-3-Bromo-4-Keto-But-2-Enoic Acid; (Z)-4-(4-Amoxyphenyl)-3-Bromo-4-Keto-But-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.20 |
| CAS Registry Number | 24740-92-9 |
| SMILES | C1=CC(=CC=C1OCCCCC)C(=O)\C(Br)=C\C(O)=O |
| InChI | 1S/C15H17BrO4/c1-2-3-4-9-20-12-7-5-11(6-8-12)15(19)13(16)10-14(17)18/h5-8,10H,2-4,9H2,1H3,(H,17,18)/b13-10- |
| InChIKey | KPUGJSNAPAAEJB-RAXLEYEMSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.109°C at 760 mmHg (Cal.) |
| Flash point | 230.251°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Pentoxybenzoyl)-3-bromoacrylic acid |