|
CAS#: 24856-80-2 Product: Ammonium Diethyl Phosphate No suppilers available for the product. |
| Name | Ammonium Diethyl Phosphate |
|---|---|
| Synonyms | Ammonium Diethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H14NO4P |
| Molecular Weight | 171.13 |
| CAS Registry Number | 24856-80-2 |
| EINECS | 246-502-5 |
| SMILES | C(O[P](OCC)([O-])=O)C.[NH4+] |
| InChI | 1S/C4H11O4P.H3N/c1-3-7-9(5,6)8-4-2;/h3-4H2,1-2H3,(H,5,6);1H3 |
| InChIKey | FOBUVCHEKOTWKT-UHFFFAOYSA-N |
| Boiling point | 200.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 74.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Diethyl Phosphate |