|
CAS#: 25001-57-4 Product: Justicidin A No suppilers available for the product. |
| Name | Justicidin A |
|---|---|
| Synonyms | 9-(1,3-Benzodioxol-5-Yl)-4,6,7-Trimethoxy-3H-Benzo[F]Isobenzofuran-1-One; Justicidins; Naphtho(2,3-C)Furan-1(3H)-One, 9-(1,3-Benzodioxol-5-Yl)-4,6,7-Trimethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 |
| CAS Registry Number | 25001-57-4 |
| SMILES | C1=C(C(=CC2=C1C(=C3C(=C2OC)COC3=O)C4=CC5=C(C=C4)OCO5)OC)OC |
| InChI | 1S/C22H18O7/c1-24-16-7-12-13(8-17(16)25-2)21(26-3)14-9-27-22(23)20(14)19(12)11-4-5-15-18(6-11)29-10-28-15/h4-8H,9-10H2,1-3H3 |
| InChIKey | ANFSXHKDCKWWDB-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 282.4±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Justicidin A |