Online Database of Chemicals from Around the World
|
CAS#: 25056-70-6 Product: Trichloroacetic acid 2-(2,4,5-trichlorophenoxy)ethyl ester No suppilers available for the product. |
| Name | Trichloroacetic acid 2-(2,4,5-trichlorophenoxy)ethyl ester |
|---|---|
| Synonyms | 2,2,2-Trichloroacetic Acid 2-(2,4,5-Trichlorophenoxy)Ethyl Ester; 2-(2,4,5-Trichlorophenoxy)Ethyl 2,2,2-Trichloroethanoate; 2-(2,4,5-Trichlorophenoxy)Ethyl Trichloroacetate |
| Molecular Structure |  |
| Molecular Formula | C10H6Cl6O3 |
| Molecular Weight | 386.87 |
| CAS Registry Number | 25056-70-6 |
| SMILES | C1=C(OCCOC(C(Cl)(Cl)Cl)=O)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C10H6Cl6O3/c11-5-3-7(13)8(4-6(5)12)18-1-2-19-9(17)10(14,15)16/h3-4H,1-2H2 |
| InChIKey | FFRUQSUMDFNBLG-UHFFFAOYSA-N |
| Density | 1.636g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.305°C at 760 mmHg (Cal.) |
| Flash point | 156.873°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloroacetic acid 2-(2,4,5-trichlorophenoxy)ethyl ester |