|
CAS#: 25063-23-4 Product: 2-Methylbutyl 4-(Dimethylamino)Benzoate No suppilers available for the product. |
| Name | 2-Methylbutyl 4-(Dimethylamino)Benzoate |
|---|---|
| Synonyms | 4-Dimethylaminobenzoic Acid 2-Methylbutyl Ester; 2-Methylbutyl 4-(Dimethylamino)Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 |
| CAS Registry Number | 25063-23-4 |
| EINECS | 246-594-7 |
| SMILES | C1=C(C(OCC(CC)C)=O)C=CC(=C1)N(C)C |
| InChI | 1S/C14H21NO2/c1-5-11(2)10-17-14(16)12-6-8-13(9-7-12)15(3)4/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | DDFJYMPPPJNZME-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.9°C at 760 mmHg (Cal.) |
| Flash point | 117.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylbutyl 4-(Dimethylamino)Benzoate |