Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Scientific Polymer Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (585) 265-0413 | |||
|
custserv@scipoly.com | |||
| Chemical manufacturer | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Poly(4-Methyl-1-Pentene) |
| Synonyms | 191000_Aldrich; Inchi=1/C6h12/C1-4-5-6(2)3/H4,6H,1,5H2,2-3H; 1-Pentene, 4-Methyl-, Homopolymer |
| Molecular Structure |  |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 |
| CAS Registry Number | 25068-26-2 |
| SMILES | C(C(C)C)C=C |
| InChI | 1S/C6H12/c1-4-5-6(2)3/h4,6H,1,5H2,2-3H3 |
| InChIKey | WSSSPWUEQFSQQG-UHFFFAOYSA-N |
| Density | 0.7±0.1g/cm3 (Cal.) |
|---|---|
| 0.664 (Expl.) | |
| Melting point | -153°C (Expl.) |
| Boiling point | 53-54°C (Expl.) |
| 56.2±7.0°C at 760 mmHg (Cal.) | |
| Flash point | -31.667°C (Cal.) |
| -32°C (Expl.) | |
| Refractive index | 1.3822 (Expl.) |
| Safety Code | S9;S16;S33;S62 Details |
|---|---|
| Risk Code | R11;R65 Details |
| Hazard Symbol |   X;F Details |
| Transport Information | UN3295 |
| Safety Description | DANGER: FLAMMABLE, irritates skin and eyes |
| DANGER: FLAMMABLE, causes narcosis, irritation | |
| 11/1/1965 12:00:00 AM | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Poly(4-Methyl-1-Pentene) |