|
CAS#: 2510-98-7 Product: 1,1'-(2-Butene-2,3-Diyl)Dibenzene No suppilers available for the product. |
| Name | 1,1'-(2-Butene-2,3-Diyl)Dibenzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 2510-98-7 |
| SMILES | C(=C(c1ccccc1)C)(c2ccccc2)C |
| InChI | 1S/C16H16/c1-13(15-9-5-3-6-10-15)14(2)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | ATYQGOFMEQUNMJ-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.383°C at 760 mmHg (Cal.) |
| Flash point | 134.469°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2-Butene-2,3-Diyl)Dibenzene |