|
CAS#: 25198-48-5 Product: 4-Chlorophenelzine No suppilers available for the product. |
| Name | 4-Chlorophenelzine |
|---|---|
| Synonyms | Hydrazine, 1-(P-Chlorophenethyl)-, Sulfate (1:1); Wl 28; P-Chloro-Beta-Phenylethylhydrazine Dihydrogen Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13ClN2O4S |
| Molecular Weight | 268.71 |
| CAS Registry Number | 25198-48-5 |
| SMILES | C1=C(C=CC(=C1)Cl)CCNN.O=[S](=O)(O)O |
| InChI | 1S/C8H11ClN2.H2O4S/c9-8-3-1-7(2-4-8)5-6-11-10;1-5(2,3)4/h1-4,11H,5-6,10H2;(H2,1,2,3,4) |
| InChIKey | VCYIKEAKVINUMM-UHFFFAOYSA-N |
| Boiling point | 314.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenelzine |