|
CAS#: 25265-76-3 Product: o-Phenylendiamine No suppilers available for the product. |
| Name | o-Phenylendiamine |
|---|---|
| Synonyms | (2-Aminophenyl)Amine; M-Phenylenediamine; P-Phenylenediamine; Phenylenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 |
| CAS Registry Number | 25265-76-3 |
| SMILES | C1=CC=CC(=C1N)N.C2=C(N)C=CC=C2N.C3=C(N)C=CC(=C3)N |
| InChI | 1S/3C6H8N2/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5;7-5-3-1-2-4-6(5)8/h3*1-4H,7-8H2 |
| InChIKey | LGZPGNGUUUOHAI-UHFFFAOYSA-N |
| Boiling point | 267.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 135.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for o-Phenylendiamine |