|
CAS#: 2529-46-6 Product: 17a-(2-Methylallyl)-17b-hydroxy-4-estren-3-one No suppilers available for the product. |
| Name | 17a-(2-Methylallyl)-17b-hydroxy-4-estren-3-one |
|---|---|
| Synonyms | 17.Alpha.-(2-Methallyl)-19-Nortestosterone; 17.Alpha.-(2-Methylallyl)-19-Nortestosterone; Estr-4-En-3-One, 17-Hydroxy-17-(2-Methyl-2-Propenyl)-, (17.Beta.)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.49 |
| CAS Registry Number | 2529-46-6 |
| SMILES | [C@H]12[C@@]([C@@](CC(C)=C)(O)CC1)(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@H]34)C |
| InChI | 1S/C22H32O2/c1-14(2)13-22(24)11-9-20-19-6-4-15-12-16(23)5-7-17(15)18(19)8-10-21(20,22)3/h12,17-20,24H,1,4-11,13H2,2-3H3/t17-,18+,19+,20-,21-,22+/m0/s1 |
| InChIKey | CKWGCYIEXSUBCE-REGVOWLASA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.548°C at 760 mmHg (Cal.) |
| Flash point | 196.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17a-(2-Methylallyl)-17b-hydroxy-4-estren-3-one |