|
CAS#: 25436-90-2 Product: Kolavenic Acid No suppilers available for the product. |
| Name | Kolavenic Acid |
|---|---|
| Synonyms | (E)-5-[(1S,2S,4Ar,8Ar)-1,2,4A,5-Tetramethyl-2,3,4,7,8,8A-Hexahydronaphthalen-1-Yl]-3-Methyl-Pent-2-Enoic Acid; (5R*,8S*,9S*,10R*)-Cleroda-3,13E-Dien-15-Oic Acid; 2-Pentenoic Acid, 3-Methyl-5-[(1S,2S,4Ar,8Ar)-1,2,3,4,4A,7,8,8A-Octahydro-1,2,4A,5-Tetramethyl-1-Naphthalenyl]-, (2E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 |
| CAS Registry Number | 25436-90-2 |
| SMILES | [C@@H]12[C@]([C@H](CC[C@]1(C(=CCC2)C)C)C)(CC\C(C)=C\C(O)=O)C |
| InChI | 1S/C20H32O2/c1-14(13-18(21)22)9-11-19(4)16(3)10-12-20(5)15(2)7-6-8-17(19)20/h7,13,16-17H,6,8-12H2,1-5H3,(H,21,22)/b14-13+/t16-,17+,19-,20-/m0/s1 |
| InChIKey | NLVMTSRTOGOFQD-SMNKCIGXSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.085°C at 760 mmHg (Cal.) |
| Flash point | 310.774°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kolavenic Acid |