|
CAS#: 2552-89-8 Product: Bis(monochloroacetyl)ajmaline hydrochloride (1:1) No suppilers available for the product. |
| Name | Bis(monochloroacetyl)ajmaline hydrochloride (1:1) |
|---|---|
| Synonyms | Ajmaline, bis(chloroacetate) (ester), hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C24H29Cl3N2O4 |
| Molecular Weight | 515.86 |
| CAS Registry Number | 2552-89-8 |
| SMILES | Cl.ClCC(=O)O[C@H]3N4[C@@H]2[C@@H]6N(c1c(cccc1)C65[C@H](OC(=O)CCl)C(C(C2)[C@@H]3CC)[C@@H]4C5)C |
| InChI | 1S/C24H28Cl2N2O4.ClH/c1-3-12-13-8-16-21-24(14-6-4-5-7-15(14)27(21)2)9-17(20(13)22(24)31-18(29)10-25)28(16)23(12)32-19(30)11-26;/h4-7,12-13,16-17,20-23H,3,8-11H2,1-2H3;1H/t12-,13?,16-,17-,20?,21-,22+,23+,24?;/m0./s1 |
| InChIKey | UWIVMLUBHUNIBC-MJSUFJGSSA-N |
| Boiling point | 580.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 304.8°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(monochloroacetyl)ajmaline hydrochloride (1:1) |