|
CAS#: 25555-13-9 Product: 4-Nitro-alpha-(Dimethylhydrazono)Acetophenone No suppilers available for the product. |
| Name | 4-Nitro-alpha-(Dimethylhydrazono)Acetophenone |
|---|---|
| Synonyms | (2E)-2-(Dimethylhydrazono)-1-(4-Nitrophenyl)Ethanone; Glyoxal, P-Nitrophenyl-, Dimethyl Hydrazone; P-Nitrophenylglyoxal N,N-Dimethylhydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 |
| CAS Registry Number | 25555-13-9 |
| SMILES | C1=C(C(=O)/C=N/N(C)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C10H11N3O3/c1-12(2)11-7-10(14)8-3-5-9(6-4-8)13(15)16/h3-7H,1-2H3/b11-7+ |
| InChIKey | XCXOXKAHWNKLJY-YRNVUSSQSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.672°C at 760 mmHg (Cal.) |
| Flash point | 177.976°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-alpha-(Dimethylhydrazono)Acetophenone |