|
CAS#: 25566-60-3 Product: Phenylmethanamine, 2,4,6-Trinitrophenol No suppilers available for the product. |
| Name | Phenylmethanamine, 2,4,6-Trinitrophenol |
|---|---|
| Synonyms | Benzylamine; 2,4,6-Trinitrophenol; Nsc77047 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N4O7 |
| Molecular Weight | 336.26 |
| CAS Registry Number | 25566-60-3 |
| SMILES | C1=C(C(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)O)[N+]([O-])=O.C2=C(CN)C=CC=C2 |
| InChI | 1S/C7H9N.C6H3N3O7/c8-6-7-4-2-1-3-5-7;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-5H,6,8H2;1-2,10H |
| InChIKey | CRBCQCHVUUTKDG-UHFFFAOYSA-N |
| Boiling point | 303.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.9°C (Cal.) |
| (1) | N. Maulucci, I. Izzo, G. Bifulco, A. Aliberti, C. De Cola, D. Comegna, C. Gaeta, A. Napolitano, C. Pizza, C. Tedesco, D. Flot and F. De Riccardis. Synthesis, structures, and properties of nine-, twelve-, and eighteen-membered N-benzyloxyethyl cyclic α-peptoids, Chem. Commun., 2008, 3927. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenylmethanamine, 2,4,6-Trinitrophenol |