|
CAS#: 25636-16-2 Product: N,N-Dimethyl-3,6-Acridinediamine No suppilers available for the product. |
| Name | N,N-Dimethyl-3,6-Acridinediamine |
|---|---|
| Synonyms | (6-Aminoacridin-3-Yl)-Dimethyl-Amine; 3,6-Acridinediamine, N,N-Dimethyl-; N,N-Dimethylprofalvine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.30 |
| CAS Registry Number | 25636-16-2 |
| SMILES | C1=C3C(=NC2=C1C=CC(=C2)N(C)C)C=C(C=C3)N |
| InChI | 1S/C15H15N3/c1-18(2)13-6-4-11-7-10-3-5-12(16)8-14(10)17-15(11)9-13/h3-9H,16H2,1-2H3 |
| InChIKey | KMXUMPXWPIYNFG-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.55°C at 760 mmHg (Cal.) |
| Flash point | 245.033°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-3,6-Acridinediamine |