|
CAS#: 25641-53-6 Product: 2-Methyldinitrophenol sodium salt No suppilers available for the product. |
| Name | 2-Methyldinitrophenol sodium salt |
|---|---|
| Synonyms | 2-Methyldinitrophenol Sodium Salt; Dnoc-Sodium; Dinitro-O-Cresol Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5N2NaO5 |
| Molecular Weight | 220.12 |
| CAS Registry Number | 25641-53-6 |
| SMILES | C1=CC=CC(=C1C([N+]([O-])=O)[N+]([O-])=O)[O-].[Na+] |
| InChI | 1S/C7H6N2O5.Na/c10-6-4-2-1-3-5(6)7(8(11)12)9(13)14;/h1-4,7,10H;/q;+1/p-1 |
| InChIKey | GYGFOKZCSXAOFF-UHFFFAOYSA-M |
| Boiling point | 329.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 147.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyldinitrophenol sodium salt |