|
CAS#: 25653-19-4 Product: 1-Diphenoxyphosphoryloxynaphthalene No suppilers available for the product. |
| Name | 1-Diphenoxyphosphoryloxynaphthalene |
|---|---|
| Synonyms | 1-Naphthyl Diphenyl Phosphate; Phosphoric Acid 1-Naphthyl Diphenyl Ester; Phosphoric Acid, 1-Naphthalenyl Diphenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17O4P |
| Molecular Weight | 376.35 |
| CAS Registry Number | 25653-19-4 |
| SMILES | C1=CC=CC=C1O[P](=O)(OC2=CC=CC=C2)OC3=C4C(=CC=C3)C=CC=C4 |
| InChI | 1S/C22H17O4P/c23-27(24-19-12-3-1-4-13-19,25-20-14-5-2-6-15-20)26-22-17-9-11-18-10-7-8-16-21(18)22/h1-17H |
| InChIKey | FVZFCHKRLYMSEQ-UHFFFAOYSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.299°C at 760 mmHg (Cal.) |
| Flash point | 250.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Diphenoxyphosphoryloxynaphthalene |