|
CAS#: 2566-26-9 Product: (2,4-Dinitrophenyl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (2,4-Dinitrophenyl) Dihydrogen Phosphate |
|---|---|
| Synonyms | 2,4-Dinitrophenol Dihydrogen Phosphate; 2,4-Dinitrophenylphosphate; Phenol, 2,4-Dinitro-, Dihydrogen Phosphate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5N2O8P |
| Molecular Weight | 264.09 |
| CAS Registry Number | 2566-26-9 |
| SMILES | C1=CC(=CC(=C1O[P](O)(O)=O)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H5N2O8P/c9-7(10)4-1-2-6(16-17(13,14)15)5(3-4)8(11)12/h1-3H,(H2,13,14,15) |
| InChIKey | OABKEGPGBFWYDX-UHFFFAOYSA-N |
| Density | 1.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.865°C at 760 mmHg (Cal.) |
| Flash point | 269.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Dinitrophenyl) Dihydrogen Phosphate |