|
CAS#: 25724-35-0 Product: 1-Amino-3-(Aminomethyl)-3,5,5-Trimethylcyclohexan-1-Ol No suppilers available for the product. |
| Name | 1-Amino-3-(Aminomethyl)-3,5,5-Trimethylcyclohexan-1-Ol |
|---|---|
| Synonyms | 1-Amino-3-(Aminomethyl)-3,5,5-Trimethyl-Cyclohexan-1-Ol; 1-Amino-3-(Aminomethyl)-3,5,5-Trimethyl-1-Cyclohexanol; 1-Amino-3-Aminomethyl-3,5,5-Trimethyl Cyclohexanol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 |
| CAS Registry Number | 25724-35-0 |
| SMILES | C(N)C1(CC(O)(N)CC(C1)(C)C)C |
| InChI | 1S/C10H22N2O/c1-8(2)4-9(3,7-11)6-10(12,13)5-8/h13H,4-7,11-12H2,1-3H3 |
| InChIKey | CECAZZROEIAEGC-UHFFFAOYSA-N |
| Density | 0.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.626°C at 760 mmHg (Cal.) |
| Flash point | 119.89°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-3-(Aminomethyl)-3,5,5-Trimethylcyclohexan-1-Ol |