| Name | 2-Carbamimidoylguanidine Sulfate |
|---|---|
| Synonyms | 2-Amidinoguanidine; Sulfuric Acid; Nsc54581; Biguanide Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H9N5O4S |
| Molecular Weight | 199.18 |
| CAS Registry Number | 2583-53-1 |
| EINECS | 219-959-3 |
| SMILES | O=[S](O)(O)=O.C(=NC(N)=N)(N)N |
| InChI | 1S/C2H7N5.H2O4S/c3-1(4)7-2(5)6;1-5(2,3)4/h(H7,3,4,5,6,7);(H2,1,2,3,4) |
| InChIKey | MIWVBVPUEOHJFV-UHFFFAOYSA-N |
| Boiling point | 267.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 115.4°C (Cal.) |
| (1) | Gopal Das, Parimal K. Bharadwaj, Debjani Ghosh, Beauty Chaudhuri and Rupendranath Banerjee. , Chem. Commun., 2001, 0, 323. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Carbamimidoylguanidine Sulfate |