|
CAS#: 25991-81-5 Product: 6,8-Dihydroxy-1,2-Dimethoxy-9H-Xanthen-9-One No suppilers available for the product. |
| Name | 6,8-Dihydroxy-1,2-Dimethoxy-9H-Xanthen-9-One |
|---|---|
| Synonyms | 6,8-Dihydroxy-1,2-Dimethoxy-Xanthen-9-One; 6,8-Dihydroxy-1,2-Dimethoxy-9-Xanthenone; 6,8-Dihydroxy-1,2-Dimethoxy-Xanthone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 |
| CAS Registry Number | 25991-81-5 |
| SMILES | C2=C1OC3=C(C(C1=C(C=C2O)O)=O)C(=C(C=C3)OC)OC |
| InChI | 1S/C15H12O6/c1-19-10-4-3-9-13(15(10)20-2)14(18)12-8(17)5-7(16)6-11(12)21-9/h3-6,16-17H,1-2H3 |
| InChIKey | BEPQKAFKFDCXTR-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.889°C at 760 mmHg (Cal.) |
| Flash point | 210.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dihydroxy-1,2-Dimethoxy-9H-Xanthen-9-One |