|
CAS#: 2601-07-2 Product: 3b-Hydroxy-5b-pregn-16-en-20-one acetate No suppilers available for the product. |
| Name | 3b-Hydroxy-5b-pregn-16-en-20-one acetate |
|---|---|
| Synonyms | Acetic Acid (17-Acetyl-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ester; (17-Ethanoyl-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ethanoate; 3.Beta.-Acetoxy-16-Allopregnene-20-One |
| Molecular Structure | ![]() |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 |
| CAS Registry Number | 2601-07-2 |
| EINECS | 220-004-8 |
| SMILES | CC34C(C2C(C1(C(CC(OC(C)=O)CC1)CC2)C)CC3)CC=C4C(C)=O |
| InChI | 1S/C23H34O3/c1-14(24)19-7-8-20-18-6-5-16-13-17(26-15(2)25)9-11-22(16,3)21(18)10-12-23(19,20)4/h7,16-18,20-21H,5-6,8-13H2,1-4H3 |
| InChIKey | YFMSIVMSEGIVCP-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.705°C at 760 mmHg (Cal.) |
| Flash point | 195.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3b-Hydroxy-5b-pregn-16-en-20-one acetate |