|
CAS#: 26070-68-8 Product: Ubisindine phosphate No suppilers available for the product. |
| Name | Ubisindine phosphate |
|---|---|
| Synonyms | 2-(2-Diethylaminoethyl)-3-Phenyl-Isoindolin-1-One; Phosphoric Acid; 2-(2-Diethylaminoethyl)-3-Phenyl-1-Isoindolinone; Phosphoric Acid; 1H-Isoindol-1-One, 2-(2-(Diethylamino)Ethyl)-2,3-Dihydro-3-Phenyl-, Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27N2O5P |
| Molecular Weight | 406.42 |
| CAS Registry Number | 26070-68-8 |
| SMILES | O=[P](O)(O)O.C1=CC=CC2=C1C(N(C2=O)CCN(CC)CC)C3=CC=CC=C3 |
| InChI | 1S/C20H24N2O.H3O4P/c1-3-21(4-2)14-15-22-19(16-10-6-5-7-11-16)17-12-8-9-13-18(17)20(22)23;1-5(2,3)4/h5-13,19H,3-4,14-15H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | FDDZTBYOCCYZRR-UHFFFAOYSA-N |
| Boiling point | 442.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ubisindine phosphate |