|
CAS#: 26078-24-0 Product: 4,6-Dimethyl-7-(Methylamino)-2-Benzopyrone No suppilers available for the product. |
| Name | 4,6-Dimethyl-7-(Methylamino)-2-Benzopyrone |
|---|---|
| Synonyms | 4,6-Dimethyl-7-Methylamino-Chromen-2-One; 4,6-Dimethyl-7-Methylamino-2-Chromenone; 4,6-Dimethyl-7-Methylamino-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 26078-24-0 |
| EINECS | 247-445-9 |
| SMILES | C1=C2C(=CC(=C1C)NC)OC(=O)C=C2C |
| InChI | 1S/C12H13NO2/c1-7-5-12(14)15-11-6-10(13-3)8(2)4-9(7)11/h4-6,13H,1-3H3 |
| InChIKey | RIZOSFDXIXBLIP-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.593°C at 760 mmHg (Cal.) |
| Flash point | 179.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyl-7-(Methylamino)-2-Benzopyrone |