|
CAS#: 2613-76-5 Product: 1,3,3-Trimethyl-1,2-Dihydroindene No suppilers available for the product. |
| Name | 1,3,3-Trimethyl-1,2-Dihydroindene |
|---|---|
| Synonyms | 1,1,3-Trimethylindane; 1,1,3-Trimethyl-[2,3-Dihydroindene]; 1,1,3-Trimethylindan |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 2613-76-5 |
| SMILES | C1=CC=C2C(=C1)C(CC2C)(C)C |
| InChI | 1S/C12H16/c1-9-8-12(2,3)11-7-5-4-6-10(9)11/h4-7,9H,8H2,1-3H3 |
| InChIKey | CPLBLNGVYBSVPU-UHFFFAOYSA-N |
| Density | 0.906g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.48°C at 760 mmHg (Cal.) |
| Flash point | 78.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethyl-1,2-Dihydroindene |