Online Database of Chemicals from Around the World
|
CAS#: 26149-08-6 Product: 2,2,2-Trifluoro-1-(Selenophene-2-Yl)-Ethanone No suppilers available for the product. |
| Name | 2,2,2-Trifluoro-1-(Selenophene-2-Yl)-Ethanone |
|---|---|
| Synonyms | 2,2,2-Trifluoro-1-Selenophen-2-Yl-Ethanone; 2,2,2-Trifluoro-1-(2-Selenophenyl)Ethanone; Ethanone,2,2,2-Trifluoro-1-(Selenophene-2-Yl)- |
| Molecular Structure |  |
| Molecular Formula | C6H3F3OSe |
| Molecular Weight | 227.04 |
| CAS Registry Number | 26149-08-6 |
| SMILES | [Se]1C(=CC=C1)C(=O)C(F)(F)F |
| InChI | 1S/C6H3F3OSe/c7-6(8,9)5(10)4-2-1-3-11-4/h1-3H |
| InChIKey | NRXQLQIDNLUXQX-UHFFFAOYSA-N |
| Boiling point | 190.853°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 69.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-(Selenophene-2-Yl)-Ethanone |