|
CAS#: 26137-53-1 Product: 1,2,3-Trimethyl-4-[(E)-Prop-1-Enyl]Naphthalene No suppilers available for the product. |
| Name | 1,2,3-Trimethyl-4-[(E)-Prop-1-Enyl]Naphthalene |
|---|---|
| Synonyms | 1,2,3-Trimethyl-4-[(1E)-1-Propenyl]Naphthalene; Naphthalene, 1,2,3-Trimethyl-4-Propenyl-, (E)-; 1,2,3-Trimethyl-4-Propenylnaphthalene (E) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 26137-53-1 |
| SMILES | C1=CC2=C(C=C1)C(=C(C)C(=C2C)C)\C=C\C |
| InChI | 1S/C16H18/c1-5-8-14-12(3)11(2)13(4)15-9-6-7-10-16(14)15/h5-10H,1-4H3/b8-5+ |
| InChIKey | GIAJIAFLVKUTLY-VMPITWQZSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.292°C at 760 mmHg (Cal.) |
| Flash point | 173.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trimethyl-4-[(E)-Prop-1-Enyl]Naphthalene |