|
CAS#: 262-76-0 Product: Corrin No suppilers available for the product. |
| Name | Corrin |
|---|---|
| Synonyms | Chebi:33221; Corrinoid; Korrin |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 |
| CAS Registry Number | 262-76-0 |
| SMILES | C1C2N=C(C1)\C=C\5NC(=C\C4=NC(=C/C3=NC2CC3)\CC4)/CC5 |
| InChI | 1S/C19H22N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h9-11,18-20H,1-8H2/b12-9-,14-10-,15-11- |
| InChIKey | PXOPDYTVWWQZEK-DPQCFBEESA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.474°C at 760 mmHg (Cal.) |
| Flash point | 244.987°C (Cal.) |
| (1) | Nicola E. Brasch, Andrew G. Cregan and Mary E. VanselowSummer vacation scholar, November 1998–January 1999.. Studies on the mechanism of the reaction between 5'-deoxyadenosylcobinamide and cyanide, Dalton Trans., 2002, 0, 1287. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Corrin |