Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N,N',N'',N'''-Tetrachloroglycoluril |
|---|---|
| Synonyms | 1,3,4,6-Tetrachloro-3A,6A-Dihydroimidazo[4,5-D]Imidazole-2,5-Quinone; Chlorinated Glycoluril |
| Molecular Structure |  |
| Molecular Formula | C4H2Cl4N4O2 |
| Molecular Weight | 279.90 |
| CAS Registry Number | 26248-99-7 |
| EINECS | 212-276-1 |
| SMILES | O=C1N(C2C(N1Cl)N(Cl)C(N2Cl)=O)Cl |
| InChI | 1S/C4H2Cl4N4O2/c5-9-1-2(11(7)3(9)13)12(8)4(14)10(1)6/h1-2H |
| InChIKey | TWVLNKKMSLYUQQ-UHFFFAOYSA-N |
| Density | 2.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.587°C at 760 mmHg (Cal.) |
| Flash point | 167.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N',N'',N'''-Tetrachloroglycoluril |