|
CAS#: 2626-34-8 Product: 5,6-Dimethyl-2,1,3-Benzoselenadiazole No suppilers available for the product. |
| Name | 5,6-Dimethyl-2,1,3-Benzoselenadiazole |
|---|---|
| Synonyms | 5,6-Dimethylpiaselenole; Brn 1072761; 5,6-Dimethyl-2,1,3-Benzoselenodiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2Se |
| Molecular Weight | 211.12 |
| CAS Registry Number | 2626-34-8 |
| SMILES | [Se]2N=C1C=C(C(=CC1=N2)C)C |
| InChI | 1S/C8H8N2Se/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3 |
| InChIKey | JXAGKGMQYSONPB-UHFFFAOYSA-N |
| Boiling point | 291.354°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 130.006°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethyl-2,1,3-Benzoselenadiazole |