|
CAS#: 2626-81-5 Product: (2-Tert-Butylphenyl) N-Methylcarbamate No suppilers available for the product. |
| Name | (2-Tert-Butylphenyl) N-Methylcarbamate |
|---|---|
| Synonyms | N-Methylcarbamic Acid (2-Tert-Butylphenyl) Ester; O-Tert-Butylphenyl Methylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 2626-81-5 |
| EINECS | 220-092-8 |
| SMILES | C1=CC=CC(=C1OC(NC)=O)C(C)(C)C |
| InChI | 1S/C12H17NO2/c1-12(2,3)9-7-5-6-8-10(9)15-11(14)13-4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | MCJHCFNLHXLNJW-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.627°C at 760 mmHg (Cal.) |
| Flash point | 123.519°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Tert-Butylphenyl) N-Methylcarbamate |