|
CAS#: 26447-49-4 Product: Hexabromododecane No suppilers available for the product. |
| Name | Hexabromododecane |
|---|---|
| Synonyms | Hexabromododecane; Dodecane, Hexabromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20Br6 |
| Molecular Weight | 643.71 |
| CAS Registry Number | 26447-49-4 |
| EINECS | 247-715-6 |
| SMILES | C(C(Br)(Br)CC)CC(Br)CCC(Br)CCC(Br)Br |
| InChI | 1S/C12H20Br6/c1-2-12(17,18)8-7-10(14)4-3-9(13)5-6-11(15)16/h9-11H,2-8H2,1H3 |
| InChIKey | DQYHBUIHXMLXFA-UHFFFAOYSA-N |
| Density | 2.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.122°C at 760 mmHg (Cal.) |
| Flash point | 302.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexabromododecane |