|
CAS#: 2648-00-2 Product: 7-Fluoro-5-Phenyl-1,3-Dihydro-1,4-Benzodiazepin-2-One No suppilers available for the product. |
| Name | 7-Fluoro-5-Phenyl-1,3-Dihydro-1,4-Benzodiazepin-2-One |
|---|---|
| Synonyms | 2H-1,4-Benzodiazepin-2-One, 7-Fluoro-1,3-Dihydro-5-Phenyl-; N-Demethylflunitrazepam |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 |
| CAS Registry Number | 2648-00-2 |
| SMILES | C1=CC2=C(C=C1F)C(=NCC(=O)N2)C3=CC=CC=C3 |
| InChI | 1S/C15H11FN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChIKey | BHRKXOYRRFPATI-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.586°C at 760 mmHg (Cal.) |
| Flash point | 208.768°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Fluoro-5-Phenyl-1,3-Dihydro-1,4-Benzodiazepin-2-One |