|
CAS#: 26501-80-4 Product: 1,4,6,7,8,8-Hexachloro-1,3a,4,6,7,7alpha-Hexahydro-4,7-Methanoisobenzofuran-5(3H)-One No suppilers available for the product. |
| Name | 1,4,6,7,8,8-Hexachloro-1,3a,4,6,7,7alpha-Hexahydro-4,7-Methanoisobenzofuran-5(3H)-One |
|---|---|
| Synonyms | Ent 27,237-X; Hooker Hrs-1694 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6Cl6O2 |
| Molecular Weight | 358.86 |
| CAS Registry Number | 26501-80-4 |
| SMILES | O=C2C3(C1COC(C1C(C2Cl)(C3(Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C9H6Cl6O2/c10-4-5(16)7(12)2-1-17-6(11)3(2)8(4,13)9(7,14)15/h2-4,6H,1H2 |
| InChIKey | CRAAWZGPLRCSTQ-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.502°C at 760 mmHg (Cal.) |
| Flash point | 186.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,6,7,8,8-Hexachloro-1,3a,4,6,7,7alpha-Hexahydro-4,7-Methanoisobenzofuran-5(3H)-One |