|
CAS#: 26533-38-0 Product: 3-Isopropenyl-6-Methyl-5-Hepten-2-One No suppilers available for the product. |
| Name | 3-Isopropenyl-6-Methyl-5-Hepten-2-One |
|---|---|
| Synonyms | 6-Methyl-3-(1-methylethenyl)-5-hepten-2-one; 6-Methyl-3-isopropenyl-5-hepten-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 26533-38-0 |
| SMILES | CC(=O)C(C/C=C(/C)C)C(\C)=C |
| InChI | 1S/C11H18O/c1-8(2)6-7-11(9(3)4)10(5)12/h6,11H,3,7H2,1-2,4-5H3 |
| InChIKey | KGXRMGREKQQQPZ-UHFFFAOYSA-N |
| Density | 0.849g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.982°C at 760 mmHg (Cal.) |
| Flash point | 80.881°C (Cal.) |
| Refractive index | 1.448 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropenyl-6-Methyl-5-Hepten-2-One |