|
CAS#: 2666-53-7 Product: Sodium 2,4,6-Tribromophenolate No suppilers available for the product. |
| Name | Sodium 2,4,6-Tribromophenolate |
|---|---|
| Synonyms | Phenol, 2,4,6-Tribromo-, Sodium Salt; Sodium 2,4,6-Tribromophenate; St5446311 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Br3NaO |
| Molecular Weight | 352.78 |
| CAS Registry Number | 2666-53-7 |
| SMILES | C1=C(Br)C=C(C(=C1Br)[O-])Br.[Na+] |
| InChI | 1S/C6H3Br3O.Na/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H;/q;+1/p-1 |
| InChIKey | SECJJZLOAVXJDP-UHFFFAOYSA-M |
| Boiling point | 286.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,4,6-Tribromophenolate |