|
CAS#: 2670-18-0 Product: 6,7-Dimethyl-4a,5,8,8alpha-Tetrahydronaphthalene-1,4-Dione No suppilers available for the product. |
| Name | 6,7-Dimethyl-4a,5,8,8alpha-Tetrahydronaphthalene-1,4-Dione |
|---|---|
| Synonyms | 6,7-Dimethyl-4A,5,8,8A-Tetrahydronaphthalene-1,4-Quinone; Nsc26999; Nsc179204 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 2670-18-0 |
| SMILES | CC1=C(C)CC2C(C1)C(=O)C=CC2=O |
| InChI | 1S/C12H14O2/c1-7-5-9-10(6-8(7)2)12(14)4-3-11(9)13/h3-4,9-10H,5-6H2,1-2H3 |
| InChIKey | IQXXMOWPSFRMSL-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.923°C at 760 mmHg (Cal.) |
| Flash point | 117.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethyl-4a,5,8,8alpha-Tetrahydronaphthalene-1,4-Dione |