|
CAS#: 26747-12-6 Product: Poly(9-Vinyladenine) No suppilers available for the product. |
| Name | Poly(9-Vinyladenine) |
|---|---|
| Synonyms | 9-Vinylpurin-6-Amine; 9-Vinyl-6-Purinamine; (9-Vinylpurin-6-Yl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 |
| CAS Registry Number | 26747-12-6 |
| SMILES | C2=NC1=C(N=CN=C1[N]2C=C)N |
| InChI | 1S/C7H7N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h2-4H,1H2,(H2,8,9,10) |
| InChIKey | FNJZRJBNAIQCGF-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.634°C at 760 mmHg (Cal.) |
| Flash point | 201.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(9-Vinyladenine) |