|
CAS#: 2686-79-5 Product: 4-Butyl-4-Methylpiperidine-2,6-Dione No suppilers available for the product. |
| Name | 4-Butyl-4-Methylpiperidine-2,6-Dione |
|---|---|
| Synonyms | 4-Butyl-4-Methyl-Piperidine-2,6-Dione; 4-Butyl-4-Methyl-Piperidine-2,6-Quinone; 2,6-Piperidinedione, 4-Butyl-4-Methyl- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 |
| CAS Registry Number | 2686-79-5 |
| SMILES | C(C)CCC1(CC(=O)NC(=O)C1)C |
| InChI | 1S/C10H17NO2/c1-3-4-5-10(2)6-8(12)11-9(13)7-10/h3-7H2,1-2H3,(H,11,12,13) |
| InChIKey | ODECDNHHLPNMMC-UHFFFAOYSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.965°C at 760 mmHg (Cal.) |
| Flash point | 126.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Butyl-4-Methylpiperidine-2,6-Dione |