|
CAS#: 26871-30-7 Product: Herquienone No suppilers available for the product. |
| Name | Herquienone |
|---|---|
| Synonyms | Herqueinone; Herquienone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 |
| CAS Registry Number | 26871-30-7 |
| SMILES | [C@]34(C(=C1C(=CC(C2=C1C(=C(C(=C2O)OC)O)C3=O)=O)C)O[C@@H](C4(C)C)C)O |
| InChI | 1S/C20H20O7/c1-7-6-9(21)11-12-10(7)18-20(25,19(3,4)8(2)27-18)17(24)13(12)15(23)16(26-5)14(11)22/h6,8,22-23,25H,1-5H3/t8-,20-/m1/s1 |
| InChIKey | PKJJEYCUTMFGJW-ZPWHCFADSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 671.9±55.0°C at 760 mmHg (Cal.) |
| Flash point | 243.8±25.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Herquienone |