|
CAS#: 2694-98-6 Product: 17a-Methyl-1,5-androstadiene-3b,17b-diol No suppilers available for the product. |
| Name | 17a-Methyl-1,5-androstadiene-3b,17b-diol |
|---|---|
| Synonyms | 17-Alpha-Methylandrosta-1,5-Diene-3-Beta,17-Beta-Diol; 17A-Methyl-1,5-Androstadiene-3B,17B Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 2694-98-6 |
| EINECS | 220-265-8 |
| SMILES | [C@]4(O)(C3(C(C1C(C2(C(=CC1)CC(O)C=C2)C)CC3)CC4)C)C |
| InChI | 1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h4,6,9,14-17,21-22H,5,7-8,10-12H2,1-3H3/t14?,15?,16?,17?,18?,19?,20-/m0/s1 |
| InChIKey | MQKCILYFKAJWDB-SYRRFROPSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.717°C at 760 mmHg (Cal.) |
| Flash point | 198.504°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17a-Methyl-1,5-androstadiene-3b,17b-diol |