Online Database of Chemicals from Around the World
|
CAS#: 26962-40-3 Product: 5-Methyl-2-(1-methylethenyl)-Benzo[1,2-b:5,4-b']difuran-4,8-dione No suppilers available for the product. |
| Name | 5-Methyl-2-(1-methylethenyl)-Benzo[1,2-b:5,4-b']difuran-4,8-dione |
|---|---|
| Synonyms | 6-Isopropenyl-3-Methyl-Furo[3,2-F]Benzofuran-4,8-Dione; 6-Isopropenyl-3-Methylfuro[3,2-F]Benzofuran-4,8-Dione; 6-Isopropenyl-3-Methyl-Furo[3,2-F]Benzofuran-4,8-Quinone |
| Molecular Structure | ![CAS#: 26962-40-3, 5-Methyl-2-(1-methylethenyl)-Benzo[1,2-b:5,4-b']difuran-4,8-dione](/moreStructures/26962-40-3.gif) |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 26962-40-3 |
| SMILES | C1=C(C(=C)C)OC3=C1C(C2=C(OC=C2C)C3=O)=O |
| InChI | 1S/C14H10O4/c1-6(2)9-4-8-11(15)10-7(3)5-17-14(10)12(16)13(8)18-9/h4-5H,1H2,2-3H3 |
| InChIKey | KFMPVUGBZZOSGH-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.039°C at 760 mmHg (Cal.) |
| Flash point | 198.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-(1-methylethenyl)-Benzo[1,2-b:5,4-b']difuran-4,8-dione |