| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,4,4,5,5-Pentafluoro-2-(Trifluoromethyl)-1,3-Oxathiolane 3,3-Dioxide |
|---|---|
| Synonyms | 2,4,4,5,5 |
| Molecular Structure | ![]() |
| Molecular Formula | C4F8O3S |
| Molecular Weight | 280.09 |
| CAS Registry Number | 26954-17-6 |
| SMILES | FC1(OC(F)(F)C(F)(F)S1(=O)=O)C(F)(F)F |
| InChI | 1S/C4F8O3S/c5-1(6,7)4(12)15-2(8,9)3(10,11)16(4,13)14 |
| InChIKey | NWYTZAWPUZPSMI-UHFFFAOYSA-N |
| Density | 1.918g/cm3 (Cal.) |
|---|---|
| Boiling point | 176.32°C at 760 mmHg (Cal.) |
| Flash point | 60.436°C (Cal.) |
| Refractive index | 1.333 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,5,5-Pentafluoro-2-(Trifluoromethyl)-1,3-Oxathiolane 3,3-Dioxide |