|
CAS#: 26968-57-0 Product: 1,2,3-Trichloro-4,5,6-Trifluorobenzene No suppilers available for the product. |
| Name | 1,2,3-Trichloro-4,5,6-Trifluorobenzene |
|---|---|
| Synonyms | Trichlorotrifluorobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl3F3 |
| Molecular Weight | 235.42 |
| CAS Registry Number | 26968-57-0 |
| SMILES | Fc1c(F)c(F)c(Cl)c(Cl)c1Cl |
| InChI | 1S/C6Cl3F3/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | BYDZRYBEVBQSAC-UHFFFAOYSA-N |
| Density | 1.707g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.411°C at 760 mmHg (Cal.) |
| Flash point | 83.679°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloro-4,5,6-Trifluorobenzene |