|
CAS#: 27060-28-2 Product: N-(4-Chlorophenyl)Pyridine-2-Carbothioamide No suppilers available for the product. |
| Name | N-(4-Chlorophenyl)Pyridine-2-Carbothioamide |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-2-Pyridinecarbothioamide; N-(4-Chlorophenyl)Thiopicolinamide; Nsc48651 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN2S |
| Molecular Weight | 248.73 |
| CAS Registry Number | 27060-28-2 |
| SMILES | C1=CC(=CC=C1NC(C2=NC=CC=C2)=S)Cl |
| InChI | 1S/C12H9ClN2S/c13-9-4-6-10(7-5-9)15-12(16)11-3-1-2-8-14-11/h1-8H,(H,15,16) |
| InChIKey | VXTYEGVJUVFYFH-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.952°C at 760 mmHg (Cal.) |
| Flash point | 183.589°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Chlorophenyl)Pyridine-2-Carbothioamide |