|
CAS#: 27156-22-5 Product: Bis(Chloromethyl)Naphthalene No suppilers available for the product. |
| Name | Bis(Chloromethyl)Naphthalene |
|---|---|
| Synonyms | Bis(Chloromethyl)Naphthalene; Bis-(Chlormethyl)Naftalen [Czech]; Naphthalene, Bis(Chloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10Cl2 |
| Molecular Weight | 225.12 |
| CAS Registry Number | 27156-22-5 |
| SMILES | C1=CC=CC2=C1C(=C(C=C2)CCl)CCl |
| InChI | 1S/C12H10Cl2/c13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14/h1-6H,7-8H2 |
| InChIKey | ILOBCCAMDOHZGW-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.35°C at 760 mmHg (Cal.) |
| Flash point | 182.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Chloromethyl)Naphthalene |